About (1-propan-2-ylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate
(1-propan-2-ylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate (PubChem CID 166885301) has the molecular formula C19H37NO2
and a molecular weight of 311.51 g/mol. Its IUPAC name is (1-propan-2-ylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate.
Molecular Properties
| Compound Name | (1-propan-2-ylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate |
| PubChem CID | 166885301 |
| Molecular Formula | C19H37NO2 |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.28 |
| IUPAC Name | (1-propan-2-ylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate |
| SMILES | CC(C)C1(OC(=O)C(C)(CC(C)(C)C)C(C)(C)N)CCCC1 |
| InChI | InChI=1S/C19H37NO2/c1-14(2)19(11-9-10-12-19)22-15(21)18(8,17(6,7)20)13-16(3,4)5/h14H,9-13,20H2,1-8H3 |
| InChIKey | XXXMYRGFKMBZNW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-propan-2-ylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-propan-2-ylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate?
The IUPAC name of (1-propan-2-ylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate (CID 166885301) is (1-propan-2-ylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate.
What is the SMILES notation for (1-propan-2-ylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate?
The canonical SMILES for (1-propan-2-ylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate is CC(C)C1(OC(=O)C(C)(CC(C)(C)C)C(C)(C)N)CCCC1.
What is the InChIKey of (1-propan-2-ylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate?
The InChIKey is XXXMYRGFKMBZNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H37NO2/c1-14(2)19(11-9-10-12-19)22-15(21)18(8,17(6,7)20)13-16(3,4)5/h14H,9-13,20H2,1-8H3.
What are the key properties of (1-propan-2-ylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate?
(1-propan-2-ylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate has a molecular weight of 311.51 g/mol, XLogP of 4.68, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-propan-2-ylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate is sourced from PubChem (CID 166885301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).