C23H26ClN7O — CID 166885534
1-[6-amino-8-(3-chloro-3-methyl-1,2-dihydropyrrolo[2,3-b]pyridin-2-yl)spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclopropane]-11-yl]-2-methylpropan-1-one (PubChem CID 166885534) has the molecular formula C23H26ClN7O and a molecular weight of 451.96 g/mol. Its IUPAC name is 1-[6-amino-8-(3-chloro-3-methyl-1,2-dihydropyrrolo[2,3-b]pyridin-2-yl)spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclopropane]-11-yl]-2-methylpropan-1-one.
| Compound Name | 1-[6-amino-8-(3-chloro-3-methyl-1,2-dihydropyrrolo[2,3-b]pyridin-2-yl)spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclopropane]-11-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 166885534 |
| Molecular Formula | C23H26ClN7O |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 1-[6-amino-8-(3-chloro-3-methyl-1,2-dihydropyrrolo[2,3-b]pyridin-2-yl)spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclopropane]-11-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1Cc2c(C3Nc4ncccc4C3(C)Cl)c3c(N)ncnc3n2C2(CC2)C1 |
| InChI | InChI=1S/C23H26ClN7O/c1-12(2)21(32)30-9-14-15(17-22(3,24)13-5-4-8-26-19(13)29-17)16-18(25)27-11-28-20(16)31(14)23(10-30)6-7-23/h4-5,8,11-12,17H,6-7,9-10H2,1-3H3,(H,26,29)(H2,25,27,28) |
| InChIKey | DTBQJQDJFMBJND-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|