C17H29FN2 — CID 166885636
(3R,4S)-1-[(2E,3E)-2-butan-2-ylidene-3-fluorohexa-3,5-dienyl]-N,N,4-trimethylpyrrolidin-3-amine (PubChem CID 166885636) has the molecular formula C17H29FN2 and a molecular weight of 280.43 g/mol. Its IUPAC name is (3R,4S)-1-[(2E,3E)-2-butan-2-ylidene-3-fluorohexa-3,5-dienyl]-N,N,4-trimethylpyrrolidin-3-amine.
| Compound Name | (3R,4S)-1-[(2E,3E)-2-butan-2-ylidene-3-fluorohexa-3,5-dienyl]-N,N,4-trimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 166885636 |
| Molecular Formula | C17H29FN2 |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | (3R,4S)-1-[(2E,3E)-2-butan-2-ylidene-3-fluorohexa-3,5-dienyl]-N,N,4-trimethylpyrrolidin-3-amine |
| SMILES | C=C/C=C(F)\C(CN1C[C@H](C)[C@@H](N(C)C)C1)=C(/C)CC |
| InChI | InChI=1S/C17H29FN2/c1-7-9-16(18)15(13(3)8-2)11-20-10-14(4)17(12-20)19(5)6/h7,9,14,17H,1,8,10-12H2,2-6H3/b15-13+,16-9+/t14-,17-/m0/s1 |
| InChIKey | JQNMMECIPOFNRD-DZKVAIDFSA-N |
| XLogP | 3.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|