C23H36N2 — CID 166885722
N'-[(Z,2E)-2-ethylidenehept-3-enyl]-N-[(3Z)-hexa-1,3,5-trien-2-yl]-N-methylcyclohexanecarboximidamide (PubChem CID 166885722) has the molecular formula C23H36N2 and a molecular weight of 340.56 g/mol. Its IUPAC name is N'-[(Z,2E)-2-ethylidenehept-3-enyl]-N-[(3Z)-hexa-1,3,5-trien-2-yl]-N-methylcyclohexanecarboximidamide.
| Compound Name | N'-[(Z,2E)-2-ethylidenehept-3-enyl]-N-[(3Z)-hexa-1,3,5-trien-2-yl]-N-methylcyclohexanecarboximidamide |
|---|---|
| PubChem CID | 166885722 |
| Molecular Formula | C23H36N2 |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.29 |
| IUPAC Name | N'-[(Z,2E)-2-ethylidenehept-3-enyl]-N-[(3Z)-hexa-1,3,5-trien-2-yl]-N-methylcyclohexanecarboximidamide |
| SMILES | C=C/C=C\C(=C)N(C)/C(=N\CC(/C=C\CCC)=C/C)C1CCCCC1 |
| InChI | InChI=1S/C23H36N2/c1-6-9-12-16-21(8-3)19-24-23(22-17-13-11-14-18-22)25(5)20(4)15-10-7-2/h7-8,10,12,15-16,22H,2,4,6,9,11,13-14,17-19H2,1,3,5H3/b15-10-,16-12-,21-8+,24-23- |
| InChIKey | JXZVYNBBLXYONP-BZNBSVPKSA-N |
| XLogP | 6.46 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|