C22H20F3N3O3 — CID 166885889
4-[[2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]ethylamino]-hydroxymethyl]piperidine-2,6-dione (PubChem CID 166885889) has the molecular formula C22H20F3N3O3 and a molecular weight of 431.41 g/mol. Its IUPAC name is 4-[[2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]ethylamino]-hydroxymethyl]piperidine-2,6-dione.
| Compound Name | 4-[[2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]ethylamino]-hydroxymethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166885889 |
| Molecular Formula | C22H20F3N3O3 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 4-[[2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]ethylamino]-hydroxymethyl]piperidine-2,6-dione |
| SMILES | O=C1CC(C(O)NCCc2c(-c3ccc(F)cc3)[nH]c3c(F)cc(F)cc23)CC(=O)N1 |
| InChI | InChI=1S/C22H20F3N3O3/c23-13-3-1-11(2-4-13)20-15(16-9-14(24)10-17(25)21(16)28-20)5-6-26-22(31)12-7-18(29)27-19(30)8-12/h1-4,9-10,12,22,26,28,31H,5-8H2,(H,27,29,30) |
| InChIKey | ROLHPFVSOJFPSU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|