C21H30FN3O2 — CID 166885952
4-[(5Z)-4-ethenyl-5-ethylidene-3-[(1Z)-4-(fluoromethyl)penta-1,4-dienyl]-2-methyl-6-oxopyrazin-1-yl]-N-ethylbutanamide (PubChem CID 166885952) has the molecular formula C21H30FN3O2 and a molecular weight of 375.49 g/mol. Its IUPAC name is 4-[(5Z)-4-ethenyl-5-ethylidene-3-[(1Z)-4-(fluoromethyl)penta-1,4-dienyl]-2-methyl-6-oxopyrazin-1-yl]-N-ethylbutanamide.
| Compound Name | 4-[(5Z)-4-ethenyl-5-ethylidene-3-[(1Z)-4-(fluoromethyl)penta-1,4-dienyl]-2-methyl-6-oxopyrazin-1-yl]-N-ethylbutanamide |
|---|---|
| PubChem CID | 166885952 |
| Molecular Formula | C21H30FN3O2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 4-[(5Z)-4-ethenyl-5-ethylidene-3-[(1Z)-4-(fluoromethyl)penta-1,4-dienyl]-2-methyl-6-oxopyrazin-1-yl]-N-ethylbutanamide |
| SMILES | C=CN1C(/C=C\CC(=C)CF)=C(C)N(CCCC(=O)NCC)C(=O)/C1=C/C |
| InChI | InChI=1S/C21H30FN3O2/c1-6-18-21(27)25(14-10-13-20(26)23-7-2)17(5)19(24(18)8-3)12-9-11-16(4)15-22/h6,8-9,12H,3-4,7,10-11,13-15H2,1-2,5H3,(H,23,26)/b12-9-,18-6- |
| InChIKey | OPCPHRMRQPRUPK-DLGAITFVSA-N |
| XLogP | 3.80 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|