C22H28N4O2 — CID 166885956
N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-4-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(13),5,9-trien-8-yl)butanamide (PubChem CID 166885956) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-4-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(13),5,9-trien-8-yl)butanamide.
| Compound Name | N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-4-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(13),5,9-trien-8-yl)butanamide |
|---|---|
| PubChem CID | 166885956 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-4-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(13),5,9-trien-8-yl)butanamide |
| SMILES | C=C(C)/C=C\C(=C/C)NC(=O)CCCN1C(=O)C2=CCCN2C2=CCCN=C21 |
| InChI | InChI=1S/C22H28N4O2/c1-4-17(12-11-16(2)3)24-20(27)10-7-15-26-21-18(8-5-13-23-21)25-14-6-9-19(25)22(26)28/h4,8-9,11-12H,2,5-7,10,13-15H2,1,3H3,(H,24,27)/b12-11-,17-4- |
| InChIKey | RYOCLBWWFXBTOD-WAQVFMMLSA-N |
| XLogP | 3.04 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|