About 2-N-(2-azidoethyl)-4-fluorobenzene-1,2-diamine
2-N-(2-azidoethyl)-4-fluorobenzene-1,2-diamine (PubChem CID 166885958) has the molecular formula C8H10FN5
and a molecular weight of 195.20 g/mol. Its IUPAC name is 2-N-(2-azidoethyl)-4-fluorobenzene-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-(2-azidoethyl)-4-fluorobenzene-1,2-diamine |
| PubChem CID | 166885958 |
| Molecular Formula | C8H10FN5 |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 2-N-(2-azidoethyl)-4-fluorobenzene-1,2-diamine |
| SMILES | [N-]=[N+]=NCCNc1cc(F)ccc1N |
| InChI | InChI=1S/C8H10FN5/c9-6-1-2-7(10)8(5-6)12-3-4-13-14-11/h1-2,5,12H,3-4,10H2 |
| InChIKey | YOIVTIBCSIOEQH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 86.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(2-azidoethyl)-4-fluorobenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(2-azidoethyl)-4-fluorobenzene-1,2-diamine?
The IUPAC name of 2-N-(2-azidoethyl)-4-fluorobenzene-1,2-diamine (CID 166885958) is 2-N-(2-azidoethyl)-4-fluorobenzene-1,2-diamine.
What is the SMILES notation for 2-N-(2-azidoethyl)-4-fluorobenzene-1,2-diamine?
The canonical SMILES for 2-N-(2-azidoethyl)-4-fluorobenzene-1,2-diamine is [N-]=[N+]=NCCNc1cc(F)ccc1N.
What is the InChIKey of 2-N-(2-azidoethyl)-4-fluorobenzene-1,2-diamine?
The InChIKey is YOIVTIBCSIOEQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FN5/c9-6-1-2-7(10)8(5-6)12-3-4-13-14-11/h1-2,5,12H,3-4,10H2.
What are the key properties of 2-N-(2-azidoethyl)-4-fluorobenzene-1,2-diamine?
2-N-(2-azidoethyl)-4-fluorobenzene-1,2-diamine has a molecular weight of 195.20 g/mol, XLogP of 2.13, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(2-azidoethyl)-4-fluorobenzene-1,2-diamine is sourced from PubChem (CID 166885958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).