About (1E,3Z)-1-chloro-3-ethylidene-5-methylhexa-1,5-dien-1-amine
(1E,3Z)-1-chloro-3-ethylidene-5-methylhexa-1,5-dien-1-amine (PubChem CID 166886247) has the molecular formula C9H14ClN
and a molecular weight of 171.67 g/mol. Its IUPAC name is (1E,3Z)-1-chloro-3-ethylidene-5-methylhexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | (1E,3Z)-1-chloro-3-ethylidene-5-methylhexa-1,5-dien-1-amine |
| PubChem CID | 166886247 |
| Molecular Formula | C9H14ClN |
| Molecular Weight | 171.67 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | (1E,3Z)-1-chloro-3-ethylidene-5-methylhexa-1,5-dien-1-amine |
| SMILES | C=C(C)CC(=C/C)/C=C(\N)Cl |
| InChI | InChI=1S/C9H14ClN/c1-4-8(5-7(2)3)6-9(10)11/h4,6H,2,5,11H2,1,3H3/b8-4-,9-6- |
| InChIKey | TUXGYADLUWSYGT-WMGNBJRUSA-N |
| XLogP | 2.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.67 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E,3Z)-1-chloro-3-ethylidene-5-methylhexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3Z)-1-chloro-3-ethylidene-5-methylhexa-1,5-dien-1-amine?
The IUPAC name of (1E,3Z)-1-chloro-3-ethylidene-5-methylhexa-1,5-dien-1-amine (CID 166886247) is (1E,3Z)-1-chloro-3-ethylidene-5-methylhexa-1,5-dien-1-amine.
What is the SMILES notation for (1E,3Z)-1-chloro-3-ethylidene-5-methylhexa-1,5-dien-1-amine?
The canonical SMILES for (1E,3Z)-1-chloro-3-ethylidene-5-methylhexa-1,5-dien-1-amine is C=C(C)CC(=C/C)/C=C(\N)Cl.
What is the InChIKey of (1E,3Z)-1-chloro-3-ethylidene-5-methylhexa-1,5-dien-1-amine?
The InChIKey is TUXGYADLUWSYGT-WMGNBJRUSA-N. The full InChI is InChI=1S/C9H14ClN/c1-4-8(5-7(2)3)6-9(10)11/h4,6H,2,5,11H2,1,3H3/b8-4-,9-6-.
What are the key properties of (1E,3Z)-1-chloro-3-ethylidene-5-methylhexa-1,5-dien-1-amine?
(1E,3Z)-1-chloro-3-ethylidene-5-methylhexa-1,5-dien-1-amine has a molecular weight of 171.67 g/mol, XLogP of 2.94, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3Z)-1-chloro-3-ethylidene-5-methylhexa-1,5-dien-1-amine is sourced from PubChem (CID 166886247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).