About N-ethyl-N-(4-ethylcyclopenta-1,3-dien-1-yl)-N'-methylpentanimidamide
N-ethyl-N-(4-ethylcyclopenta-1,3-dien-1-yl)-N'-methylpentanimidamide (PubChem CID 166886864) has the molecular formula C15H26N2
and a molecular weight of 234.39 g/mol. Its IUPAC name is N-ethyl-N-(4-ethylcyclopenta-1,3-dien-1-yl)-N'-methylpentanimidamide.
Molecular Properties
| Compound Name | N-ethyl-N-(4-ethylcyclopenta-1,3-dien-1-yl)-N'-methylpentanimidamide |
| PubChem CID | 166886864 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | N-ethyl-N-(4-ethylcyclopenta-1,3-dien-1-yl)-N'-methylpentanimidamide |
| SMILES | CCCC/C(=N\C)N(CC)C1=CC=C(CC)C1 |
| InChI | InChI=1S/C15H26N2/c1-5-8-9-15(16-4)17(7-3)14-11-10-13(6-2)12-14/h10-11H,5-9,12H2,1-4H3/b16-15+ |
| InChIKey | ZBRQCSZHSDRJIT-FOCLMDBBSA-N |
| XLogP | 4.15 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-(4-ethylcyclopenta-1,3-dien-1-yl)-N'-methylpentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-(4-ethylcyclopenta-1,3-dien-1-yl)-N'-methylpentanimidamide?
The IUPAC name of N-ethyl-N-(4-ethylcyclopenta-1,3-dien-1-yl)-N'-methylpentanimidamide (CID 166886864) is N-ethyl-N-(4-ethylcyclopenta-1,3-dien-1-yl)-N'-methylpentanimidamide.
What is the SMILES notation for N-ethyl-N-(4-ethylcyclopenta-1,3-dien-1-yl)-N'-methylpentanimidamide?
The canonical SMILES for N-ethyl-N-(4-ethylcyclopenta-1,3-dien-1-yl)-N'-methylpentanimidamide is CCCC/C(=N\C)N(CC)C1=CC=C(CC)C1.
What is the InChIKey of N-ethyl-N-(4-ethylcyclopenta-1,3-dien-1-yl)-N'-methylpentanimidamide?
The InChIKey is ZBRQCSZHSDRJIT-FOCLMDBBSA-N. The full InChI is InChI=1S/C15H26N2/c1-5-8-9-15(16-4)17(7-3)14-11-10-13(6-2)12-14/h10-11H,5-9,12H2,1-4H3/b16-15+.
What are the key properties of N-ethyl-N-(4-ethylcyclopenta-1,3-dien-1-yl)-N'-methylpentanimidamide?
N-ethyl-N-(4-ethylcyclopenta-1,3-dien-1-yl)-N'-methylpentanimidamide has a molecular weight of 234.39 g/mol, XLogP of 4.15, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-(4-ethylcyclopenta-1,3-dien-1-yl)-N'-methylpentanimidamide is sourced from PubChem (CID 166886864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).