C20H21IN2O3S — CID 166886869
4-[2-(iodomethylsulfanyl)-4-(piperidine-1-carbonyl)anilino]benzoic acid (PubChem CID 166886869) has the molecular formula C20H21IN2O3S and a molecular weight of 496.37 g/mol. Its IUPAC name is 4-[2-(iodomethylsulfanyl)-4-(piperidine-1-carbonyl)anilino]benzoic acid.
| Compound Name | 4-[2-(iodomethylsulfanyl)-4-(piperidine-1-carbonyl)anilino]benzoic acid |
|---|---|
| PubChem CID | 166886869 |
| Molecular Formula | C20H21IN2O3S |
| Molecular Weight | 496.37 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | 4-[2-(iodomethylsulfanyl)-4-(piperidine-1-carbonyl)anilino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2ccc(C(=O)N3CCCCC3)cc2SCI)cc1 |
| InChI | InChI=1S/C20H21IN2O3S/c21-13-27-18-12-15(19(24)23-10-2-1-3-11-23)6-9-17(18)22-16-7-4-14(5-8-16)20(25)26/h4-9,12,22H,1-3,10-11,13H2,(H,25,26) |
| InChIKey | MSEJQEMHVNBEOT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.37 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|