C15H15FN4 — CID 166887258
[4-(3,4-dihydro-2H-1,8-naphthyridin-1-yl)-2-fluorophenyl]-methyldiazene (PubChem CID 166887258) has the molecular formula C15H15FN4 and a molecular weight of 270.31 g/mol. Its IUPAC name is [4-(3,4-dihydro-2H-1,8-naphthyridin-1-yl)-2-fluorophenyl]-methyldiazene.
| Compound Name | [4-(3,4-dihydro-2H-1,8-naphthyridin-1-yl)-2-fluorophenyl]-methyldiazene |
|---|---|
| PubChem CID | 166887258 |
| Molecular Formula | C15H15FN4 |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | [4-(3,4-dihydro-2H-1,8-naphthyridin-1-yl)-2-fluorophenyl]-methyldiazene |
| SMILES | C/N=N/c1ccc(N2CCCc3cccnc32)cc1F |
| InChI | InChI=1S/C15H15FN4/c1-17-19-14-7-6-12(10-13(14)16)20-9-3-5-11-4-2-8-18-15(11)20/h2,4,6-8,10H,3,5,9H2,1H3/b19-17+ |
| InChIKey | ZHLOWZABOOAEAY-HTXNQAPBSA-N |
| XLogP | 4.02 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|