C22H17F3N2O2 — CID 166887651
(2S,3R)-2-amino-9-ethoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene-8-carbonitrile (PubChem CID 166887651) has the molecular formula C22H17F3N2O2 and a molecular weight of 398.38 g/mol. Its IUPAC name is (2S,3R)-2-amino-9-ethoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene-8-carbonitrile.
| Compound Name | (2S,3R)-2-amino-9-ethoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene-8-carbonitrile |
|---|---|
| PubChem CID | 166887651 |
| Molecular Formula | C22H17F3N2O2 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (2S,3R)-2-amino-9-ethoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene-8-carbonitrile |
| SMILES | CCOc1cc2c3c(ccc2cc1C#N)O[C@H](c1cc(F)c(F)cc1F)[C@@H](N)C3 |
| InChI | InChI=1S/C22H17F3N2O2/c1-2-28-21-8-13-11(5-12(21)10-26)3-4-20-14(13)7-19(27)22(29-20)15-6-17(24)18(25)9-16(15)23/h3-6,8-9,19,22H,2,7,27H2,1H3/t19-,22+/m0/s1 |
| InChIKey | DGVXPCREQZZZRT-SIKLNZKXSA-N |
| XLogP | 4.53 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|