C20H15F3O3S — CID 166887667
6-methylsulfonyl-2-(2,4,5-trifluorophenyl)-3,4-dihydro-2H-benzo[h]chromene (PubChem CID 166887667) has the molecular formula C20H15F3O3S and a molecular weight of 392.40 g/mol. Its IUPAC name is 6-methylsulfonyl-2-(2,4,5-trifluorophenyl)-3,4-dihydro-2H-benzo[h]chromene.
| Compound Name | 6-methylsulfonyl-2-(2,4,5-trifluorophenyl)-3,4-dihydro-2H-benzo[h]chromene |
|---|---|
| PubChem CID | 166887667 |
| Molecular Formula | C20H15F3O3S |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 6-methylsulfonyl-2-(2,4,5-trifluorophenyl)-3,4-dihydro-2H-benzo[h]chromene |
| SMILES | CS(=O)(=O)c1cc2c(c3ccccc13)OC(c1cc(F)c(F)cc1F)CC2 |
| InChI | InChI=1S/C20H15F3O3S/c1-27(24,25)19-8-11-6-7-18(14-9-16(22)17(23)10-15(14)21)26-20(11)13-5-3-2-4-12(13)19/h2-5,8-10,18H,6-7H2,1H3 |
| InChIKey | FGRVRPDEIBMPEF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|