About 2,2,2-trifluoro-N'-methyl-N-[(E)-2-(methylamino)ethenyl]ethanimidamide
2,2,2-trifluoro-N'-methyl-N-[(E)-2-(methylamino)ethenyl]ethanimidamide (PubChem CID 166888833) has the molecular formula C6H10F3N3
and a molecular weight of 181.16 g/mol. Its IUPAC name is 2,2,2-trifluoro-N'-methyl-N-[(E)-2-(methylamino)ethenyl]ethanimidamide.
Molecular Properties
| Compound Name | 2,2,2-trifluoro-N'-methyl-N-[(E)-2-(methylamino)ethenyl]ethanimidamide |
| PubChem CID | 166888833 |
| Molecular Formula | C6H10F3N3 |
| Molecular Weight | 181.16 g/mol |
| Exact Mass | 181.08 |
| IUPAC Name | 2,2,2-trifluoro-N'-methyl-N-[(E)-2-(methylamino)ethenyl]ethanimidamide |
| SMILES | C/N=C(\N/C=C/NC)C(F)(F)F |
| InChI | InChI=1S/C6H10F3N3/c1-10-3-4-12-5(11-2)6(7,8)9/h3-4,10H,1-2H3,(H,11,12)/b4-3+ |
| InChIKey | MVOZFPCDNQUJJH-ONEGZZNKSA-N |
| XLogP | 0.86 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoro-N'-methyl-N-[(E)-2-(methylamino)ethenyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoro-N'-methyl-N-[(E)-2-(methylamino)ethenyl]ethanimidamide?
The IUPAC name of 2,2,2-trifluoro-N'-methyl-N-[(E)-2-(methylamino)ethenyl]ethanimidamide (CID 166888833) is 2,2,2-trifluoro-N'-methyl-N-[(E)-2-(methylamino)ethenyl]ethanimidamide.
What is the SMILES notation for 2,2,2-trifluoro-N'-methyl-N-[(E)-2-(methylamino)ethenyl]ethanimidamide?
The canonical SMILES for 2,2,2-trifluoro-N'-methyl-N-[(E)-2-(methylamino)ethenyl]ethanimidamide is C/N=C(\N/C=C/NC)C(F)(F)F.
What is the InChIKey of 2,2,2-trifluoro-N'-methyl-N-[(E)-2-(methylamino)ethenyl]ethanimidamide?
The InChIKey is MVOZFPCDNQUJJH-ONEGZZNKSA-N. The full InChI is InChI=1S/C6H10F3N3/c1-10-3-4-12-5(11-2)6(7,8)9/h3-4,10H,1-2H3,(H,11,12)/b4-3+.
What are the key properties of 2,2,2-trifluoro-N'-methyl-N-[(E)-2-(methylamino)ethenyl]ethanimidamide?
2,2,2-trifluoro-N'-methyl-N-[(E)-2-(methylamino)ethenyl]ethanimidamide has a molecular weight of 181.16 g/mol, XLogP of 0.86, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-N'-methyl-N-[(E)-2-(methylamino)ethenyl]ethanimidamide is sourced from PubChem (CID 166888833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).