C11H18F2N2 — CID 166888907
1-N'-[(2Z,4Z)-4,5-difluoro-6-methylhepta-2,4,6-trienyl]-1-N-methylethane-1,1-diamine (PubChem CID 166888907) has the molecular formula C11H18F2N2 and a molecular weight of 216.27 g/mol. Its IUPAC name is 1-N'-[(2Z,4Z)-4,5-difluoro-6-methylhepta-2,4,6-trienyl]-1-N-methylethane-1,1-diamine.
| Compound Name | 1-N'-[(2Z,4Z)-4,5-difluoro-6-methylhepta-2,4,6-trienyl]-1-N-methylethane-1,1-diamine |
|---|---|
| PubChem CID | 166888907 |
| Molecular Formula | C11H18F2N2 |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 1-N'-[(2Z,4Z)-4,5-difluoro-6-methylhepta-2,4,6-trienyl]-1-N-methylethane-1,1-diamine |
| SMILES | C=C(C)/C(F)=C(F)\C=C/CNC(C)NC |
| InChI | InChI=1S/C11H18F2N2/c1-8(2)11(13)10(12)6-5-7-15-9(3)14-4/h5-6,9,14-15H,1,7H2,2-4H3/b6-5-,11-10- |
| InChIKey | WLBZRVVDGHIWHL-VIFBMRGNSA-N |
| XLogP | 2.42 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|