About (2R)-1,3,3-trifluoro-2-methyl-3-(oxolan-2-yl)propan-1-amine
(2R)-1,3,3-trifluoro-2-methyl-3-(oxolan-2-yl)propan-1-amine (PubChem CID 166889514) has the molecular formula C8H14F3NO
and a molecular weight of 197.20 g/mol. Its IUPAC name is (2R)-1,3,3-trifluoro-2-methyl-3-(oxolan-2-yl)propan-1-amine.
Molecular Properties
| Compound Name | (2R)-1,3,3-trifluoro-2-methyl-3-(oxolan-2-yl)propan-1-amine |
| PubChem CID | 166889514 |
| Molecular Formula | C8H14F3NO |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (2R)-1,3,3-trifluoro-2-methyl-3-(oxolan-2-yl)propan-1-amine |
| SMILES | C[C@H](C(N)F)C(F)(F)C1CCCO1 |
| InChI | InChI=1S/C8H14F3NO/c1-5(7(9)12)8(10,11)6-3-2-4-13-6/h5-7H,2-4,12H2,1H3/t5-,6?,7?/m1/s1 |
| InChIKey | XGMKCOQMBLNPKI-GRQBKTHUSA-N |
| XLogP | 1.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1,3,3-trifluoro-2-methyl-3-(oxolan-2-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,3,3-trifluoro-2-methyl-3-(oxolan-2-yl)propan-1-amine?
The IUPAC name of (2R)-1,3,3-trifluoro-2-methyl-3-(oxolan-2-yl)propan-1-amine (CID 166889514) is (2R)-1,3,3-trifluoro-2-methyl-3-(oxolan-2-yl)propan-1-amine.
What is the SMILES notation for (2R)-1,3,3-trifluoro-2-methyl-3-(oxolan-2-yl)propan-1-amine?
The canonical SMILES for (2R)-1,3,3-trifluoro-2-methyl-3-(oxolan-2-yl)propan-1-amine is C[C@H](C(N)F)C(F)(F)C1CCCO1.
What is the InChIKey of (2R)-1,3,3-trifluoro-2-methyl-3-(oxolan-2-yl)propan-1-amine?
The InChIKey is XGMKCOQMBLNPKI-GRQBKTHUSA-N. The full InChI is InChI=1S/C8H14F3NO/c1-5(7(9)12)8(10,11)6-3-2-4-13-6/h5-7H,2-4,12H2,1H3/t5-,6?,7?/m1/s1.
What are the key properties of (2R)-1,3,3-trifluoro-2-methyl-3-(oxolan-2-yl)propan-1-amine?
(2R)-1,3,3-trifluoro-2-methyl-3-(oxolan-2-yl)propan-1-amine has a molecular weight of 197.20 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,3,3-trifluoro-2-methyl-3-(oxolan-2-yl)propan-1-amine is sourced from PubChem (CID 166889514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).