C25H25F3N4O — CID 166889791
N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-2-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)-8,9-dihydrofuro[2,3-h]quinazolin-4-amine (PubChem CID 166889791) has the molecular formula C25H25F3N4O and a molecular weight of 454.50 g/mol. Its IUPAC name is N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-2-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)-8,9-dihydrofuro[2,3-h]quinazolin-4-amine.
| Compound Name | N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-2-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)-8,9-dihydrofuro[2,3-h]quinazolin-4-amine |
|---|---|
| PubChem CID | 166889791 |
| Molecular Formula | C25H25F3N4O |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-2-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)-8,9-dihydrofuro[2,3-h]quinazolin-4-amine |
| SMILES | Cc1nc(N[C@H](C)c2cccc(C(F)F)c2F)c2cc(C3=CCNCC3)c3c(c2n1)CCO3 |
| InChI | InChI=1S/C25H25F3N4O/c1-13(16-4-3-5-17(21(16)26)24(27)28)30-25-20-12-19(15-6-9-29-10-7-15)23-18(8-11-33-23)22(20)31-14(2)32-25/h3-6,12-13,24,29H,7-11H2,1-2H3,(H,30,31,32)/t13-/m1/s1 |
| InChIKey | BOTPYHFJBGKVQM-CYBMUJFWSA-N |
| XLogP | 5.50 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |