About (6Z)-4-bromo-2-methyl-6-(3-methylidene-1,4-dioxan-2-ylidene)-4,5-dihydro-1H-pyrimidine
(6Z)-4-bromo-2-methyl-6-(3-methylidene-1,4-dioxan-2-ylidene)-4,5-dihydro-1H-pyrimidine (PubChem CID 166889792) has the molecular formula C10H13BrN2O2
and a molecular weight of 273.13 g/mol. Its IUPAC name is (6Z)-4-bromo-2-methyl-6-(3-methylidene-1,4-dioxan-2-ylidene)-4,5-dihydro-1H-pyrimidine.
Molecular Properties
| Compound Name | (6Z)-4-bromo-2-methyl-6-(3-methylidene-1,4-dioxan-2-ylidene)-4,5-dihydro-1H-pyrimidine |
| PubChem CID | 166889792 |
| Molecular Formula | C10H13BrN2O2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | (6Z)-4-bromo-2-methyl-6-(3-methylidene-1,4-dioxan-2-ylidene)-4,5-dihydro-1H-pyrimidine |
| SMILES | C=C1OCCO/C1=C1/CC(Br)N=C(C)N1 |
| InChI | InChI=1S/C10H13BrN2O2/c1-6-10(15-4-3-14-6)8-5-9(11)13-7(2)12-8/h9H,1,3-5H2,2H3,(H,12,13)/b10-8- |
| InChIKey | IIJXASLXNVJEQU-NTMALXAHSA-N |
| XLogP | 1.89 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-4-bromo-2-methyl-6-(3-methylidene-1,4-dioxan-2-ylidene)-4,5-dihydro-1H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-4-bromo-2-methyl-6-(3-methylidene-1,4-dioxan-2-ylidene)-4,5-dihydro-1H-pyrimidine?
The IUPAC name of (6Z)-4-bromo-2-methyl-6-(3-methylidene-1,4-dioxan-2-ylidene)-4,5-dihydro-1H-pyrimidine (CID 166889792) is (6Z)-4-bromo-2-methyl-6-(3-methylidene-1,4-dioxan-2-ylidene)-4,5-dihydro-1H-pyrimidine.
What is the SMILES notation for (6Z)-4-bromo-2-methyl-6-(3-methylidene-1,4-dioxan-2-ylidene)-4,5-dihydro-1H-pyrimidine?
The canonical SMILES for (6Z)-4-bromo-2-methyl-6-(3-methylidene-1,4-dioxan-2-ylidene)-4,5-dihydro-1H-pyrimidine is C=C1OCCO/C1=C1/CC(Br)N=C(C)N1.
What is the InChIKey of (6Z)-4-bromo-2-methyl-6-(3-methylidene-1,4-dioxan-2-ylidene)-4,5-dihydro-1H-pyrimidine?
The InChIKey is IIJXASLXNVJEQU-NTMALXAHSA-N. The full InChI is InChI=1S/C10H13BrN2O2/c1-6-10(15-4-3-14-6)8-5-9(11)13-7(2)12-8/h9H,1,3-5H2,2H3,(H,12,13)/b10-8-.
What are the key properties of (6Z)-4-bromo-2-methyl-6-(3-methylidene-1,4-dioxan-2-ylidene)-4,5-dihydro-1H-pyrimidine?
(6Z)-4-bromo-2-methyl-6-(3-methylidene-1,4-dioxan-2-ylidene)-4,5-dihydro-1H-pyrimidine has a molecular weight of 273.13 g/mol, XLogP of 1.89, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-4-bromo-2-methyl-6-(3-methylidene-1,4-dioxan-2-ylidene)-4,5-dihydro-1H-pyrimidine is sourced from PubChem (CID 166889792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).