About tributyl(3,4-dihydronaphthalen-1-yloxy)stannane
tributyl(3,4-dihydronaphthalen-1-yloxy)stannane (PubChem CID 16689009) has the molecular formula C22H36OSn
and a molecular weight of 435.24 g/mol. Its IUPAC name is tributyl(3,4-dihydronaphthalen-1-yloxy)stannane.
Molecular Properties
| Compound Name | tributyl(3,4-dihydronaphthalen-1-yloxy)stannane |
| PubChem CID | 16689009 |
| Molecular Formula | C22H36OSn |
| Molecular Weight | 435.24 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | tributyl(3,4-dihydronaphthalen-1-yloxy)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)OC1=CCCc2ccccc21 |
| InChI | InChI=1S/C10H10O.3C4H9.Sn/c11-10-7-3-5-8-4-1-2-6-9(8)10;3*1-3-4-2;/h1-2,4,6-7,11H,3,5H2;3*1,3-4H2,2H3;/q;;;;+1/p-1 |
| InChIKey | BYBNPTGTELTHCY-UHFFFAOYSA-M |
| XLogP | 7.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.24 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tributyl(3,4-dihydronaphthalen-1-yloxy)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl(3,4-dihydronaphthalen-1-yloxy)stannane?
The IUPAC name of tributyl(3,4-dihydronaphthalen-1-yloxy)stannane (CID 16689009) is tributyl(3,4-dihydronaphthalen-1-yloxy)stannane.
What is the SMILES notation for tributyl(3,4-dihydronaphthalen-1-yloxy)stannane?
The canonical SMILES for tributyl(3,4-dihydronaphthalen-1-yloxy)stannane is CCCC[Sn](CCCC)(CCCC)OC1=CCCc2ccccc21.
What is the InChIKey of tributyl(3,4-dihydronaphthalen-1-yloxy)stannane?
The InChIKey is BYBNPTGTELTHCY-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H10O.3C4H9.Sn/c11-10-7-3-5-8-4-1-2-6-9(8)10;3*1-3-4-2;/h1-2,4,6-7,11H,3,5H2;3*1,3-4H2,2H3;/q;;;;+1/p-1.
What are the key properties of tributyl(3,4-dihydronaphthalen-1-yloxy)stannane?
tributyl(3,4-dihydronaphthalen-1-yloxy)stannane has a molecular weight of 435.24 g/mol, XLogP of 7.34, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl(3,4-dihydronaphthalen-1-yloxy)stannane is sourced from PubChem (CID 16689009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).