C64H56N6O4 — CID 166890594
10,20-bis(3,5-dimethylphenyl)-5-N,5-N,15-N,15-N-tetrakis(4-methoxyphenyl)-21,23-dihydroporphyrin-5,15-diamine (PubChem CID 166890594) has the molecular formula C64H56N6O4 and a molecular weight of 973.19 g/mol. Its IUPAC name is 10,20-bis(3,5-dimethylphenyl)-5-N,5-N,15-N,15-N-tetrakis(4-methoxyphenyl)-21,23-dihydroporphyrin-5,15-diamine.
| Compound Name | 10,20-bis(3,5-dimethylphenyl)-5-N,5-N,15-N,15-N-tetrakis(4-methoxyphenyl)-21,23-dihydroporphyrin-5,15-diamine |
|---|---|
| PubChem CID | 166890594 |
| Molecular Formula | C64H56N6O4 |
| Molecular Weight | 973.19 g/mol |
| Exact Mass | 972.44 |
| IUPAC Name | 10,20-bis(3,5-dimethylphenyl)-5-N,5-N,15-N,15-N-tetrakis(4-methoxyphenyl)-21,23-dihydroporphyrin-5,15-diamine |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2c3nc(c(-c4cc(C)cc(C)c4)c4ccc([nH]4)c(N(c4ccc(OC)cc4)c4ccc(OC)cc4)c4nc(c(-c5cc(C)cc(C)c5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C64H56N6O4/c1-39-33-40(2)36-43(35-39)61-53-25-29-57(65-53)63(69(45-9-17-49(71-5)18-10-45)46-11-19-50(72-6)20-12-46)59-31-27-55(67-59)62(44-37-41(3)34-42(4)38-44)56-28-32-60(68-56)64(58-30-26-54(61)66-58)70(47-13-21-51(73-7)22-14-47)48-15-23-52(74-8)24-16-48/h9-38,65,68H,1-8H3/b61-53-,61-54-,62-55-,62-56-,63-57+,63-59+,64-58+,64-60+ |
| InChIKey | CJKCTNFFFYFTBI-HZPGTIQNSA-N |
| XLogP | 16.20 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.19 |
| LogP ≤ 5 | 16.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |