C32H24Cl4NO4Sb — CID 16689070
(4R,7S)-2-[tetrakis(4-chlorophenyl)-lambda5-stibanyl]oxy-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 16689070) has the molecular formula C32H24Cl4NO4Sb and a molecular weight of 750.12 g/mol. Its IUPAC name is (4R,7S)-2-[tetrakis(4-chlorophenyl)-lambda5-stibanyl]oxy-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (4R,7S)-2-[tetrakis(4-chlorophenyl)-lambda5-stibanyl]oxy-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 16689070 |
| Molecular Formula | C32H24Cl4NO4Sb |
| Molecular Weight | 750.12 g/mol |
| Exact Mass | 746.95 |
| IUPAC Name | (4R,7S)-2-[tetrakis(4-chlorophenyl)-lambda5-stibanyl]oxy-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | O=C1C2C(C(=O)N1O[Sb](c1ccc(Cl)cc1)(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)c1ccc(Cl)cc1)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C8H8NO4.4C6H4Cl.Sb/c10-7-5-3-1-2-4(13-3)6(5)8(11)9(7)12;4*7-6-4-2-1-3-5-6;/h3-6H,1-2H2;4*2-5H;/q-1;;;;;+1/t3-,4+,5?,6?;;;;; |
| InChIKey | ZBIHQUDENCCGJB-VACHWRCBSA-N |
| XLogP | 5.22 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.12 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|