About 5-(cyanomethyl)-2-methylcyclohexa-2,4-diene-1-carbonitrile
5-(cyanomethyl)-2-methylcyclohexa-2,4-diene-1-carbonitrile (PubChem CID 166891236) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 5-(cyanomethyl)-2-methylcyclohexa-2,4-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 5-(cyanomethyl)-2-methylcyclohexa-2,4-diene-1-carbonitrile |
| PubChem CID | 166891236 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 5-(cyanomethyl)-2-methylcyclohexa-2,4-diene-1-carbonitrile |
| SMILES | CC1=CC=C(CC#N)CC1C#N |
| InChI | InChI=1S/C10H10N2/c1-8-2-3-9(4-5-11)6-10(8)7-12/h2-3,10H,4,6H2,1H3 |
| InChIKey | LDYZXXYJNPGJCB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(cyanomethyl)-2-methylcyclohexa-2,4-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cyanomethyl)-2-methylcyclohexa-2,4-diene-1-carbonitrile?
The IUPAC name of 5-(cyanomethyl)-2-methylcyclohexa-2,4-diene-1-carbonitrile (CID 166891236) is 5-(cyanomethyl)-2-methylcyclohexa-2,4-diene-1-carbonitrile.
What is the SMILES notation for 5-(cyanomethyl)-2-methylcyclohexa-2,4-diene-1-carbonitrile?
The canonical SMILES for 5-(cyanomethyl)-2-methylcyclohexa-2,4-diene-1-carbonitrile is CC1=CC=C(CC#N)CC1C#N.
What is the InChIKey of 5-(cyanomethyl)-2-methylcyclohexa-2,4-diene-1-carbonitrile?
The InChIKey is LDYZXXYJNPGJCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c1-8-2-3-9(4-5-11)6-10(8)7-12/h2-3,10H,4,6H2,1H3.
What are the key properties of 5-(cyanomethyl)-2-methylcyclohexa-2,4-diene-1-carbonitrile?
5-(cyanomethyl)-2-methylcyclohexa-2,4-diene-1-carbonitrile has a molecular weight of 158.20 g/mol, XLogP of 2.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyanomethyl)-2-methylcyclohexa-2,4-diene-1-carbonitrile is sourced from PubChem (CID 166891236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).