About 4-[methyl-[(2E)-4-methylpenta-2,4-dienyl]amino]butanal
4-[methyl-[(2E)-4-methylpenta-2,4-dienyl]amino]butanal (PubChem CID 166891391) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-[methyl-[(2E)-4-methylpenta-2,4-dienyl]amino]butanal.
Molecular Properties
| Compound Name | 4-[methyl-[(2E)-4-methylpenta-2,4-dienyl]amino]butanal |
| PubChem CID | 166891391 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 4-[methyl-[(2E)-4-methylpenta-2,4-dienyl]amino]butanal |
| SMILES | C=C(C)/C=C/CN(C)CCCC=O |
| InChI | InChI=1S/C11H19NO/c1-11(2)7-6-9-12(3)8-4-5-10-13/h6-7,10H,1,4-5,8-9H2,2-3H3/b7-6+ |
| InChIKey | VYWQAQORONPADP-VOTSOKGWSA-N |
| XLogP | 2.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[methyl-[(2E)-4-methylpenta-2,4-dienyl]amino]butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[methyl-[(2E)-4-methylpenta-2,4-dienyl]amino]butanal?
The IUPAC name of 4-[methyl-[(2E)-4-methylpenta-2,4-dienyl]amino]butanal (CID 166891391) is 4-[methyl-[(2E)-4-methylpenta-2,4-dienyl]amino]butanal.
What is the SMILES notation for 4-[methyl-[(2E)-4-methylpenta-2,4-dienyl]amino]butanal?
The canonical SMILES for 4-[methyl-[(2E)-4-methylpenta-2,4-dienyl]amino]butanal is C=C(C)/C=C/CN(C)CCCC=O.
What is the InChIKey of 4-[methyl-[(2E)-4-methylpenta-2,4-dienyl]amino]butanal?
The InChIKey is VYWQAQORONPADP-VOTSOKGWSA-N. The full InChI is InChI=1S/C11H19NO/c1-11(2)7-6-9-12(3)8-4-5-10-13/h6-7,10H,1,4-5,8-9H2,2-3H3/b7-6+.
What are the key properties of 4-[methyl-[(2E)-4-methylpenta-2,4-dienyl]amino]butanal?
4-[methyl-[(2E)-4-methylpenta-2,4-dienyl]amino]butanal has a molecular weight of 181.28 g/mol, XLogP of 2.03, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[methyl-[(2E)-4-methylpenta-2,4-dienyl]amino]butanal is sourced from PubChem (CID 166891391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).