About 2,4-ditert-butyl-5-methyl-6H-1,3-thiazine
2,4-ditert-butyl-5-methyl-6H-1,3-thiazine (PubChem CID 166891520) has the molecular formula C13H23NS
and a molecular weight of 225.40 g/mol. Its IUPAC name is 2,4-ditert-butyl-5-methyl-6H-1,3-thiazine.
Molecular Properties
| Compound Name | 2,4-ditert-butyl-5-methyl-6H-1,3-thiazine |
| PubChem CID | 166891520 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 2,4-ditert-butyl-5-methyl-6H-1,3-thiazine |
| SMILES | CC1=C(C(C)(C)C)N=C(C(C)(C)C)SC1 |
| InChI | InChI=1S/C13H23NS/c1-9-8-15-11(13(5,6)7)14-10(9)12(2,3)4/h8H2,1-7H3 |
| InChIKey | OVKOBRSBMOQJDL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-ditert-butyl-5-methyl-6H-1,3-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-ditert-butyl-5-methyl-6H-1,3-thiazine?
The IUPAC name of 2,4-ditert-butyl-5-methyl-6H-1,3-thiazine (CID 166891520) is 2,4-ditert-butyl-5-methyl-6H-1,3-thiazine.
What is the SMILES notation for 2,4-ditert-butyl-5-methyl-6H-1,3-thiazine?
The canonical SMILES for 2,4-ditert-butyl-5-methyl-6H-1,3-thiazine is CC1=C(C(C)(C)C)N=C(C(C)(C)C)SC1.
What is the InChIKey of 2,4-ditert-butyl-5-methyl-6H-1,3-thiazine?
The InChIKey is OVKOBRSBMOQJDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NS/c1-9-8-15-11(13(5,6)7)14-10(9)12(2,3)4/h8H2,1-7H3.
What are the key properties of 2,4-ditert-butyl-5-methyl-6H-1,3-thiazine?
2,4-ditert-butyl-5-methyl-6H-1,3-thiazine has a molecular weight of 225.40 g/mol, XLogP of 4.50, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-ditert-butyl-5-methyl-6H-1,3-thiazine is sourced from PubChem (CID 166891520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).