C16H20F6N2O3 — CID 166891532
2,2,2-trifluoro-N-[1-[(1R,2S,5S)-2-formyl-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-oxo-3-(trifluoromethyl)pentan-2-yl]acetamide (PubChem CID 166891532) has the molecular formula C16H20F6N2O3 and a molecular weight of 402.34 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[1-[(1R,2S,5S)-2-formyl-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-oxo-3-(trifluoromethyl)pentan-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[1-[(1R,2S,5S)-2-formyl-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-oxo-3-(trifluoromethyl)pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 166891532 |
| Molecular Formula | C16H20F6N2O3 |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2,2,2-trifluoro-N-[1-[(1R,2S,5S)-2-formyl-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-oxo-3-(trifluoromethyl)pentan-2-yl]acetamide |
| SMILES | CCC(C(NC(=O)C(F)(F)F)C(=O)N1C[C@H]2[C@@H]([C@H]1C=O)C2(C)C)C(F)(F)F |
| InChI | InChI=1S/C16H20F6N2O3/c1-4-7(15(17,18)19)11(23-13(27)16(20,21)22)12(26)24-5-8-10(9(24)6-25)14(8,2)3/h6-11H,4-5H2,1-3H3,(H,23,27)/t7?,8-,9+,10-,11?/m0/s1 |
| InChIKey | UDYQFXYPYLNQFP-OIYZBFHHSA-N |
| XLogP | 2.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|