About 5,5-difluoro-3-methyl-6,7-dihydro-1H-indol-4-one
5,5-difluoro-3-methyl-6,7-dihydro-1H-indol-4-one (PubChem CID 166891852) has the molecular formula C9H9F2NO
and a molecular weight of 185.17 g/mol. Its IUPAC name is 5,5-difluoro-3-methyl-6,7-dihydro-1H-indol-4-one.
Molecular Properties
| Compound Name | 5,5-difluoro-3-methyl-6,7-dihydro-1H-indol-4-one |
| PubChem CID | 166891852 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 5,5-difluoro-3-methyl-6,7-dihydro-1H-indol-4-one |
| SMILES | Cc1c[nH]c2c1C(=O)C(F)(F)CC2 |
| InChI | InChI=1S/C9H9F2NO/c1-5-4-12-6-2-3-9(10,11)8(13)7(5)6/h4,12H,2-3H2,1H3 |
| InChIKey | WCWNQJKCPTYSLZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,5-difluoro-3-methyl-6,7-dihydro-1H-indol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-difluoro-3-methyl-6,7-dihydro-1H-indol-4-one?
The IUPAC name of 5,5-difluoro-3-methyl-6,7-dihydro-1H-indol-4-one (CID 166891852) is 5,5-difluoro-3-methyl-6,7-dihydro-1H-indol-4-one.
What is the SMILES notation for 5,5-difluoro-3-methyl-6,7-dihydro-1H-indol-4-one?
The canonical SMILES for 5,5-difluoro-3-methyl-6,7-dihydro-1H-indol-4-one is Cc1c[nH]c2c1C(=O)C(F)(F)CC2.
What is the InChIKey of 5,5-difluoro-3-methyl-6,7-dihydro-1H-indol-4-one?
The InChIKey is WCWNQJKCPTYSLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO/c1-5-4-12-6-2-3-9(10,11)8(13)7(5)6/h4,12H,2-3H2,1H3.
What are the key properties of 5,5-difluoro-3-methyl-6,7-dihydro-1H-indol-4-one?
5,5-difluoro-3-methyl-6,7-dihydro-1H-indol-4-one has a molecular weight of 185.17 g/mol, XLogP of 2.09, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluoro-3-methyl-6,7-dihydro-1H-indol-4-one is sourced from PubChem (CID 166891852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).