C24H22FNO3S — CID 166892126
methyl (2E,4E)-5-[2-[2-[[(3-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]amino]phenyl]ethynyl]-2-methylhepta-2,4,6-trienoate (PubChem CID 166892126) has the molecular formula C24H22FNO3S and a molecular weight of 423.51 g/mol. Its IUPAC name is methyl (2E,4E)-5-[2-[2-[[(3-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]amino]phenyl]ethynyl]-2-methylhepta-2,4,6-trienoate.
| Compound Name | methyl (2E,4E)-5-[2-[2-[[(3-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]amino]phenyl]ethynyl]-2-methylhepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 166892126 |
| Molecular Formula | C24H22FNO3S |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | methyl (2E,4E)-5-[2-[2-[[(3-fluorophenyl)-methyl-oxo-λ6-sulfanylidene]amino]phenyl]ethynyl]-2-methylhepta-2,4,6-trienoate |
| SMILES | C=C/C(C#Cc1ccccc1N=S(C)(=O)c1cccc(F)c1)=C\C=C(/C)C(=O)OC |
| InChI | InChI=1S/C24H22FNO3S/c1-5-19(14-13-18(2)24(27)29-3)15-16-20-9-6-7-12-23(20)26-30(4,28)22-11-8-10-21(25)17-22/h5-14,17H,1H2,2-4H3/b18-13+,19-14+ |
| InChIKey | JIXPGDWNLWAEIT-JIBZRZDWSA-N |
| XLogP | 5.20 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|