About 1-(1-benzofuran-5-yl)-4,4,4-trichloro-2-(methylamino)butan-1-one
1-(1-benzofuran-5-yl)-4,4,4-trichloro-2-(methylamino)butan-1-one (PubChem CID 166892596) has the molecular formula C13H12Cl3NO2
and a molecular weight of 320.60 g/mol. Its IUPAC name is 1-(1-benzofuran-5-yl)-4,4,4-trichloro-2-(methylamino)butan-1-one.
Molecular Properties
| Compound Name | 1-(1-benzofuran-5-yl)-4,4,4-trichloro-2-(methylamino)butan-1-one |
| PubChem CID | 166892596 |
| Molecular Formula | C13H12Cl3NO2 |
| Molecular Weight | 320.60 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 1-(1-benzofuran-5-yl)-4,4,4-trichloro-2-(methylamino)butan-1-one |
| SMILES | CNC(CC(Cl)(Cl)Cl)C(=O)c1ccc2occc2c1 |
| InChI | InChI=1S/C13H12Cl3NO2/c1-17-10(7-13(14,15)16)12(18)9-2-3-11-8(6-9)4-5-19-11/h2-6,10,17H,7H2,1H3 |
| InChIKey | SWNOOJXLYQUVBQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.60 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-benzofuran-5-yl)-4,4,4-trichloro-2-(methylamino)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-benzofuran-5-yl)-4,4,4-trichloro-2-(methylamino)butan-1-one?
The IUPAC name of 1-(1-benzofuran-5-yl)-4,4,4-trichloro-2-(methylamino)butan-1-one (CID 166892596) is 1-(1-benzofuran-5-yl)-4,4,4-trichloro-2-(methylamino)butan-1-one.
What is the SMILES notation for 1-(1-benzofuran-5-yl)-4,4,4-trichloro-2-(methylamino)butan-1-one?
The canonical SMILES for 1-(1-benzofuran-5-yl)-4,4,4-trichloro-2-(methylamino)butan-1-one is CNC(CC(Cl)(Cl)Cl)C(=O)c1ccc2occc2c1.
What is the InChIKey of 1-(1-benzofuran-5-yl)-4,4,4-trichloro-2-(methylamino)butan-1-one?
The InChIKey is SWNOOJXLYQUVBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl3NO2/c1-17-10(7-13(14,15)16)12(18)9-2-3-11-8(6-9)4-5-19-11/h2-6,10,17H,7H2,1H3.
What are the key properties of 1-(1-benzofuran-5-yl)-4,4,4-trichloro-2-(methylamino)butan-1-one?
1-(1-benzofuran-5-yl)-4,4,4-trichloro-2-(methylamino)butan-1-one has a molecular weight of 320.60 g/mol, XLogP of 3.96, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-benzofuran-5-yl)-4,4,4-trichloro-2-(methylamino)butan-1-one is sourced from PubChem (CID 166892596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).