About (5E)-6-(2-methoxy-6-methyl-3-pyridinyl)-4-methylidenehepta-1,5-dien-3-imine
(5E)-6-(2-methoxy-6-methyl-3-pyridinyl)-4-methylidenehepta-1,5-dien-3-imine (PubChem CID 166892910) has the molecular formula C15H18N2O
and a molecular weight of 242.32 g/mol. Its IUPAC name is (5E)-6-(2-methoxy-6-methyl-3-pyridinyl)-4-methylidenehepta-1,5-dien-3-imine.
Molecular Properties
| Compound Name | (5E)-6-(2-methoxy-6-methyl-3-pyridinyl)-4-methylidenehepta-1,5-dien-3-imine |
| PubChem CID | 166892910 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | (5E)-6-(2-methoxy-6-methyl-3-pyridinyl)-4-methylidenehepta-1,5-dien-3-imine |
| SMILES | [H]/N=C(\C=C)C(=C)/C=C(\C)c1ccc(C)nc1OC |
| InChI | InChI=1S/C15H18N2O/c1-6-14(16)11(3)9-10(2)13-8-7-12(4)17-15(13)18-5/h6-9,16H,1,3H2,2,4-5H3/b10-9+,16-14+ |
| InChIKey | SEFGMHTXDRVZQB-WAJBHNFBSA-N |
| XLogP | 3.56 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-6-(2-methoxy-6-methyl-3-pyridinyl)-4-methylidenehepta-1,5-dien-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-6-(2-methoxy-6-methyl-3-pyridinyl)-4-methylidenehepta-1,5-dien-3-imine?
The IUPAC name of (5E)-6-(2-methoxy-6-methyl-3-pyridinyl)-4-methylidenehepta-1,5-dien-3-imine (CID 166892910) is (5E)-6-(2-methoxy-6-methyl-3-pyridinyl)-4-methylidenehepta-1,5-dien-3-imine.
What is the SMILES notation for (5E)-6-(2-methoxy-6-methyl-3-pyridinyl)-4-methylidenehepta-1,5-dien-3-imine?
The canonical SMILES for (5E)-6-(2-methoxy-6-methyl-3-pyridinyl)-4-methylidenehepta-1,5-dien-3-imine is [H]/N=C(\C=C)C(=C)/C=C(\C)c1ccc(C)nc1OC.
What is the InChIKey of (5E)-6-(2-methoxy-6-methyl-3-pyridinyl)-4-methylidenehepta-1,5-dien-3-imine?
The InChIKey is SEFGMHTXDRVZQB-WAJBHNFBSA-N. The full InChI is InChI=1S/C15H18N2O/c1-6-14(16)11(3)9-10(2)13-8-7-12(4)17-15(13)18-5/h6-9,16H,1,3H2,2,4-5H3/b10-9+,16-14+.
What are the key properties of (5E)-6-(2-methoxy-6-methyl-3-pyridinyl)-4-methylidenehepta-1,5-dien-3-imine?
(5E)-6-(2-methoxy-6-methyl-3-pyridinyl)-4-methylidenehepta-1,5-dien-3-imine has a molecular weight of 242.32 g/mol, XLogP of 3.56, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-6-(2-methoxy-6-methyl-3-pyridinyl)-4-methylidenehepta-1,5-dien-3-imine is sourced from PubChem (CID 166892910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).