C11H14FNO — CID 166893340
6-fluoro-3,3,3a-trimethyl-1,7a-dihydroindol-2-one (PubChem CID 166893340) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is 6-fluoro-3,3,3a-trimethyl-1,7a-dihydroindol-2-one.
| Compound Name | 6-fluoro-3,3,3a-trimethyl-1,7a-dihydroindol-2-one |
|---|---|
| PubChem CID | 166893340 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 6-fluoro-3,3,3a-trimethyl-1,7a-dihydroindol-2-one |
| SMILES | CC1(C)C(=O)NC2C=C(F)C=CC21C |
| InChI | InChI=1S/C11H14FNO/c1-10(2)9(14)13-8-6-7(12)4-5-11(8,10)3/h4-6,8H,1-3H3,(H,13,14) |
| InChIKey | XGPVLEMZUADCPA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |