C9H10FNO — CID 166893417
(3R)-5-fluoro-3-methyl-1,3,3a,7a-tetrahydroindol-2-one (PubChem CID 166893417) has the molecular formula C9H10FNO and a molecular weight of 167.18 g/mol. Its IUPAC name is (3R)-5-fluoro-3-methyl-1,3,3a,7a-tetrahydroindol-2-one.
| Compound Name | (3R)-5-fluoro-3-methyl-1,3,3a,7a-tetrahydroindol-2-one |
|---|---|
| PubChem CID | 166893417 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | (3R)-5-fluoro-3-methyl-1,3,3a,7a-tetrahydroindol-2-one |
| SMILES | C[C@H]1C(=O)NC2C=CC(F)=CC21 |
| InChI | InChI=1S/C9H10FNO/c1-5-7-4-6(10)2-3-8(7)11-9(5)12/h2-5,7-8H,1H3,(H,11,12)/t5-,7?,8?/m1/s1 |
| InChIKey | LNPXVJMMMUIMCG-LDXLETFUSA-N |
| XLogP | 1.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |