About 4-methyl-3-(2,2,2-trifluoroethylamino)-1H-pyridin-2-one
4-methyl-3-(2,2,2-trifluoroethylamino)-1H-pyridin-2-one (PubChem CID 166893458) has the molecular formula C8H9F3N2O
and a molecular weight of 206.17 g/mol. Its IUPAC name is 4-methyl-3-(2,2,2-trifluoroethylamino)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-methyl-3-(2,2,2-trifluoroethylamino)-1H-pyridin-2-one |
| PubChem CID | 166893458 |
| Molecular Formula | C8H9F3N2O |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 4-methyl-3-(2,2,2-trifluoroethylamino)-1H-pyridin-2-one |
| SMILES | Cc1cc[nH]c(=O)c1NCC(F)(F)F |
| InChI | InChI=1S/C8H9F3N2O/c1-5-2-3-12-7(14)6(5)13-4-8(9,10)11/h2-3,13H,4H2,1H3,(H,12,14) |
| InChIKey | VXEZFKNYGJFJKN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-3-(2,2,2-trifluoroethylamino)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-(2,2,2-trifluoroethylamino)-1H-pyridin-2-one?
The IUPAC name of 4-methyl-3-(2,2,2-trifluoroethylamino)-1H-pyridin-2-one (CID 166893458) is 4-methyl-3-(2,2,2-trifluoroethylamino)-1H-pyridin-2-one.
What is the SMILES notation for 4-methyl-3-(2,2,2-trifluoroethylamino)-1H-pyridin-2-one?
The canonical SMILES for 4-methyl-3-(2,2,2-trifluoroethylamino)-1H-pyridin-2-one is Cc1cc[nH]c(=O)c1NCC(F)(F)F.
What is the InChIKey of 4-methyl-3-(2,2,2-trifluoroethylamino)-1H-pyridin-2-one?
The InChIKey is VXEZFKNYGJFJKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O/c1-5-2-3-12-7(14)6(5)13-4-8(9,10)11/h2-3,13H,4H2,1H3,(H,12,14).
What are the key properties of 4-methyl-3-(2,2,2-trifluoroethylamino)-1H-pyridin-2-one?
4-methyl-3-(2,2,2-trifluoroethylamino)-1H-pyridin-2-one has a molecular weight of 206.17 g/mol, XLogP of 1.66, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-(2,2,2-trifluoroethylamino)-1H-pyridin-2-one is sourced from PubChem (CID 166893458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).