C31H25NO4S — CID 166894147
[3-[4-[4-[(E)-N-(1-hydroxyethoxy)-C-methylcarbonimidoyl]phenyl]sulfanylphenyl]-1-benzofuran-2-yl]-phenylmethanone (PubChem CID 166894147) has the molecular formula C31H25NO4S and a molecular weight of 507.61 g/mol. Its IUPAC name is [3-[4-[4-[(E)-N-(1-hydroxyethoxy)-C-methylcarbonimidoyl]phenyl]sulfanylphenyl]-1-benzofuran-2-yl]-phenylmethanone.
| Compound Name | [3-[4-[4-[(E)-N-(1-hydroxyethoxy)-C-methylcarbonimidoyl]phenyl]sulfanylphenyl]-1-benzofuran-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 166894147 |
| Molecular Formula | C31H25NO4S |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | [3-[4-[4-[(E)-N-(1-hydroxyethoxy)-C-methylcarbonimidoyl]phenyl]sulfanylphenyl]-1-benzofuran-2-yl]-phenylmethanone |
| SMILES | C/C(=N\OC(C)O)c1ccc(Sc2ccc(-c3c(C(=O)c4ccccc4)oc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C31H25NO4S/c1-20(32-36-21(2)33)22-12-16-25(17-13-22)37-26-18-14-23(15-19-26)29-27-10-6-7-11-28(27)35-31(29)30(34)24-8-4-3-5-9-24/h3-19,21,33H,1-2H3/b32-20+ |
| InChIKey | NZEGMZVJPUAHRF-UZWMFBFFSA-N |
| XLogP | 7.56 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|