C20H26ClFN4O2 — CID 166894284
N-[(3-chloro-2-fluorophenyl)methyl]-2-[cyclopropyl-[2-[methylamino-[(2E)-penta-2,4-dien-2-yl]amino]acetyl]amino]acetamide (PubChem CID 166894284) has the molecular formula C20H26ClFN4O2 and a molecular weight of 408.91 g/mol. Its IUPAC name is N-[(3-chloro-2-fluorophenyl)methyl]-2-[cyclopropyl-[2-[methylamino-[(2E)-penta-2,4-dien-2-yl]amino]acetyl]amino]acetamide.
| Compound Name | N-[(3-chloro-2-fluorophenyl)methyl]-2-[cyclopropyl-[2-[methylamino-[(2E)-penta-2,4-dien-2-yl]amino]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 166894284 |
| Molecular Formula | C20H26ClFN4O2 |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | N-[(3-chloro-2-fluorophenyl)methyl]-2-[cyclopropyl-[2-[methylamino-[(2E)-penta-2,4-dien-2-yl]amino]acetyl]amino]acetamide |
| SMILES | C=C/C=C(\C)N(CC(=O)N(CC(=O)NCc1cccc(Cl)c1F)C1CC1)NC |
| InChI | InChI=1S/C20H26ClFN4O2/c1-4-6-14(2)26(23-3)13-19(28)25(16-9-10-16)12-18(27)24-11-15-7-5-8-17(21)20(15)22/h4-8,16,23H,1,9-13H2,2-3H3,(H,24,27)/b14-6+ |
| InChIKey | UUCDLJXNYSNJRI-MKMNVTDBSA-N |
| XLogP | 2.61 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|