About N-butyl-2-chloro-3-(2,3-dihydro-1H-inden-4-yl)-N-methylaniline
N-butyl-2-chloro-3-(2,3-dihydro-1H-inden-4-yl)-N-methylaniline (PubChem CID 166894542) has the molecular formula C20H24ClN
and a molecular weight of 313.87 g/mol. Its IUPAC name is N-butyl-2-chloro-3-(2,3-dihydro-1H-inden-4-yl)-N-methylaniline.
Molecular Properties
| Compound Name | N-butyl-2-chloro-3-(2,3-dihydro-1H-inden-4-yl)-N-methylaniline |
| PubChem CID | 166894542 |
| Molecular Formula | C20H24ClN |
| Molecular Weight | 313.87 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | N-butyl-2-chloro-3-(2,3-dihydro-1H-inden-4-yl)-N-methylaniline |
| SMILES | CCCCN(C)c1cccc(-c2cccc3c2CCC3)c1Cl |
| InChI | InChI=1S/C20H24ClN/c1-3-4-14-22(2)19-13-7-12-18(20(19)21)17-11-6-9-15-8-5-10-16(15)17/h6-7,9,11-13H,3-5,8,10,14H2,1-2H3 |
| InChIKey | UTXKNFZJJOMBMC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.87 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-butyl-2-chloro-3-(2,3-dihydro-1H-inden-4-yl)-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-chloro-3-(2,3-dihydro-1H-inden-4-yl)-N-methylaniline?
The IUPAC name of N-butyl-2-chloro-3-(2,3-dihydro-1H-inden-4-yl)-N-methylaniline (CID 166894542) is N-butyl-2-chloro-3-(2,3-dihydro-1H-inden-4-yl)-N-methylaniline.
What is the SMILES notation for N-butyl-2-chloro-3-(2,3-dihydro-1H-inden-4-yl)-N-methylaniline?
The canonical SMILES for N-butyl-2-chloro-3-(2,3-dihydro-1H-inden-4-yl)-N-methylaniline is CCCCN(C)c1cccc(-c2cccc3c2CCC3)c1Cl.
What is the InChIKey of N-butyl-2-chloro-3-(2,3-dihydro-1H-inden-4-yl)-N-methylaniline?
The InChIKey is UTXKNFZJJOMBMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24ClN/c1-3-4-14-22(2)19-13-7-12-18(20(19)21)17-11-6-9-15-8-5-10-16(15)17/h6-7,9,11-13H,3-5,8,10,14H2,1-2H3.
What are the key properties of N-butyl-2-chloro-3-(2,3-dihydro-1H-inden-4-yl)-N-methylaniline?
N-butyl-2-chloro-3-(2,3-dihydro-1H-inden-4-yl)-N-methylaniline has a molecular weight of 313.87 g/mol, XLogP of 5.73, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-chloro-3-(2,3-dihydro-1H-inden-4-yl)-N-methylaniline is sourced from PubChem (CID 166894542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).