About 8-ethyl-4-methyl-5,6-dihydro-1,3-diazocine
8-ethyl-4-methyl-5,6-dihydro-1,3-diazocine (PubChem CID 166894802) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 8-ethyl-4-methyl-5,6-dihydro-1,3-diazocine.
Molecular Properties
| Compound Name | 8-ethyl-4-methyl-5,6-dihydro-1,3-diazocine |
| PubChem CID | 166894802 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 8-ethyl-4-methyl-5,6-dihydro-1,3-diazocine |
| SMILES | CCC1=CCC/C(C)=N\C=N/1 |
| InChI | InChI=1S/C9H14N2/c1-3-9-6-4-5-8(2)10-7-11-9/h6-7H,3-5H2,1-2H3/b9-6?,10-8-,11-7- |
| InChIKey | VJZAFOMDLRJTJN-BHIKVUFYSA-N |
| XLogP | 2.56 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-ethyl-4-methyl-5,6-dihydro-1,3-diazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-4-methyl-5,6-dihydro-1,3-diazocine?
The IUPAC name of 8-ethyl-4-methyl-5,6-dihydro-1,3-diazocine (CID 166894802) is 8-ethyl-4-methyl-5,6-dihydro-1,3-diazocine.
What is the SMILES notation for 8-ethyl-4-methyl-5,6-dihydro-1,3-diazocine?
The canonical SMILES for 8-ethyl-4-methyl-5,6-dihydro-1,3-diazocine is CCC1=CCC/C(C)=N\C=N/1.
What is the InChIKey of 8-ethyl-4-methyl-5,6-dihydro-1,3-diazocine?
The InChIKey is VJZAFOMDLRJTJN-BHIKVUFYSA-N. The full InChI is InChI=1S/C9H14N2/c1-3-9-6-4-5-8(2)10-7-11-9/h6-7H,3-5H2,1-2H3/b9-6?,10-8-,11-7-.
What are the key properties of 8-ethyl-4-methyl-5,6-dihydro-1,3-diazocine?
8-ethyl-4-methyl-5,6-dihydro-1,3-diazocine has a molecular weight of 150.22 g/mol, XLogP of 2.56, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-4-methyl-5,6-dihydro-1,3-diazocine is sourced from PubChem (CID 166894802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).