C14H25NO — CID 166895226
(2E,6Z)-2-butyl-6-methoxynona-2,6,8-trien-1-amine (PubChem CID 166895226) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is (2E,6Z)-2-butyl-6-methoxynona-2,6,8-trien-1-amine.
| Compound Name | (2E,6Z)-2-butyl-6-methoxynona-2,6,8-trien-1-amine |
|---|---|
| PubChem CID | 166895226 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (2E,6Z)-2-butyl-6-methoxynona-2,6,8-trien-1-amine |
| SMILES | C=C/C=C(/CC/C=C(/CN)CCCC)OC |
| InChI | InChI=1S/C14H25NO/c1-4-6-9-13(12-15)10-7-11-14(16-3)8-5-2/h5,8,10H,2,4,6-7,9,11-12,15H2,1,3H3/b13-10+,14-8- |
| InChIKey | ZBLPNULHVBRGIE-QBJQURNTSA-N |
| XLogP | 3.56 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|