C21H26F2O8S — CID 166895840
2-[2-[[6-(2-ethyl-2-hydroxybutyl)naphthalen-1-yl]methoxy]acetyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid (PubChem CID 166895840) has the molecular formula C21H26F2O8S and a molecular weight of 476.49 g/mol. Its IUPAC name is 2-[2-[[6-(2-ethyl-2-hydroxybutyl)naphthalen-1-yl]methoxy]acetyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid.
| Compound Name | 2-[2-[[6-(2-ethyl-2-hydroxybutyl)naphthalen-1-yl]methoxy]acetyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid |
|---|---|
| PubChem CID | 166895840 |
| Molecular Formula | C21H26F2O8S |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 2-[2-[[6-(2-ethyl-2-hydroxybutyl)naphthalen-1-yl]methoxy]acetyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid |
| SMILES | CCC(O)(CC)Cc1ccc2c(COCC(=O)OC(O)C(F)(F)S(=O)(=O)O)cccc2c1 |
| InChI | InChI=1S/C21H26F2O8S/c1-3-20(26,4-2)11-14-8-9-17-15(10-14)6-5-7-16(17)12-30-13-18(24)31-19(25)21(22,23)32(27,28)29/h5-10,19,25-26H,3-4,11-13H2,1-2H3,(H,27,28,29) |
| InChIKey | PTJVMTHQIIRMLJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|