C15H25N3O — CID 166896566
7-(methyliminomethyl)-4-pentan-3-yl-6-[(Z)-prop-1-enyl]-2,3-dihydro-1H-1,4-diazepin-5-one (PubChem CID 166896566) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 7-(methyliminomethyl)-4-pentan-3-yl-6-[(Z)-prop-1-enyl]-2,3-dihydro-1H-1,4-diazepin-5-one.
| Compound Name | 7-(methyliminomethyl)-4-pentan-3-yl-6-[(Z)-prop-1-enyl]-2,3-dihydro-1H-1,4-diazepin-5-one |
|---|---|
| PubChem CID | 166896566 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 7-(methyliminomethyl)-4-pentan-3-yl-6-[(Z)-prop-1-enyl]-2,3-dihydro-1H-1,4-diazepin-5-one |
| SMILES | C/C=C\C1=C(/C=N/C)NCCN(C(CC)CC)C1=O |
| InChI | InChI=1S/C15H25N3O/c1-5-8-13-14(11-16-4)17-9-10-18(15(13)19)12(6-2)7-3/h5,8,11-12,17H,6-7,9-10H2,1-4H3/b8-5-,16-11+ |
| InChIKey | OIFZSBAPVAQXSY-UOPFFVFUSA-N |
| XLogP | 2.14 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|