About 1-[(4Z)-5-ethyl-3,4-dimethylhepta-4,6-dien-2-yl]-1-methylhydrazine
1-[(4Z)-5-ethyl-3,4-dimethylhepta-4,6-dien-2-yl]-1-methylhydrazine (PubChem CID 166896625) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 1-[(4Z)-5-ethyl-3,4-dimethylhepta-4,6-dien-2-yl]-1-methylhydrazine.
Molecular Properties
| Compound Name | 1-[(4Z)-5-ethyl-3,4-dimethylhepta-4,6-dien-2-yl]-1-methylhydrazine |
| PubChem CID | 166896625 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 1-[(4Z)-5-ethyl-3,4-dimethylhepta-4,6-dien-2-yl]-1-methylhydrazine |
| SMILES | C=C/C(CC)=C(/C)C(C)C(C)N(C)N |
| InChI | InChI=1S/C12H24N2/c1-7-12(8-2)10(4)9(3)11(5)14(6)13/h7,9,11H,1,8,13H2,2-6H3/b12-10+ |
| InChIKey | ZXZCPQDUIUMPQS-ZRDIBKRKSA-N |
| XLogP | 2.73 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4Z)-5-ethyl-3,4-dimethylhepta-4,6-dien-2-yl]-1-methylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4Z)-5-ethyl-3,4-dimethylhepta-4,6-dien-2-yl]-1-methylhydrazine?
The IUPAC name of 1-[(4Z)-5-ethyl-3,4-dimethylhepta-4,6-dien-2-yl]-1-methylhydrazine (CID 166896625) is 1-[(4Z)-5-ethyl-3,4-dimethylhepta-4,6-dien-2-yl]-1-methylhydrazine.
What is the SMILES notation for 1-[(4Z)-5-ethyl-3,4-dimethylhepta-4,6-dien-2-yl]-1-methylhydrazine?
The canonical SMILES for 1-[(4Z)-5-ethyl-3,4-dimethylhepta-4,6-dien-2-yl]-1-methylhydrazine is C=C/C(CC)=C(/C)C(C)C(C)N(C)N.
What is the InChIKey of 1-[(4Z)-5-ethyl-3,4-dimethylhepta-4,6-dien-2-yl]-1-methylhydrazine?
The InChIKey is ZXZCPQDUIUMPQS-ZRDIBKRKSA-N. The full InChI is InChI=1S/C12H24N2/c1-7-12(8-2)10(4)9(3)11(5)14(6)13/h7,9,11H,1,8,13H2,2-6H3/b12-10+.
What are the key properties of 1-[(4Z)-5-ethyl-3,4-dimethylhepta-4,6-dien-2-yl]-1-methylhydrazine?
1-[(4Z)-5-ethyl-3,4-dimethylhepta-4,6-dien-2-yl]-1-methylhydrazine has a molecular weight of 196.34 g/mol, XLogP of 2.73, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4Z)-5-ethyl-3,4-dimethylhepta-4,6-dien-2-yl]-1-methylhydrazine is sourced from PubChem (CID 166896625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).