C10H13N7 — CID 166898024
(1E,3Z)-2-N-(3-methyl-2H-pyrazolo[4,3-d]pyrimidin-7-yl)buta-1,3-diene-1,2,4-triamine (PubChem CID 166898024) has the molecular formula C10H13N7 and a molecular weight of 231.26 g/mol. Its IUPAC name is (1E,3Z)-2-N-(3-methyl-2H-pyrazolo[4,3-d]pyrimidin-7-yl)buta-1,3-diene-1,2,4-triamine.
| Compound Name | (1E,3Z)-2-N-(3-methyl-2H-pyrazolo[4,3-d]pyrimidin-7-yl)buta-1,3-diene-1,2,4-triamine |
|---|---|
| PubChem CID | 166898024 |
| Molecular Formula | C10H13N7 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | (1E,3Z)-2-N-(3-methyl-2H-pyrazolo[4,3-d]pyrimidin-7-yl)buta-1,3-diene-1,2,4-triamine |
| SMILES | Cc1[nH]nc2c(NC(/C=C\N)=C/N)ncnc12 |
| InChI | InChI=1S/C10H13N7/c1-6-8-9(17-16-6)10(14-5-13-8)15-7(4-12)2-3-11/h2-5H,11-12H2,1H3,(H,16,17)(H,13,14,15)/b3-2-,7-4+ |
| InChIKey | MFHCHAXAGSWHPK-UDJLOATDSA-N |
| XLogP | 0.35 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|