C6H10INO3 — CID 166898026
O-(6-iodo-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)hydroxylamine (PubChem CID 166898026) has the molecular formula C6H10INO3 and a molecular weight of 271.05 g/mol. Its IUPAC name is O-(6-iodo-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)hydroxylamine.
| Compound Name | O-(6-iodo-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)hydroxylamine |
|---|---|
| PubChem CID | 166898026 |
| Molecular Formula | C6H10INO3 |
| Molecular Weight | 271.05 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | O-(6-iodo-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)hydroxylamine |
| SMILES | NOC1COC2C(I)COC12 |
| InChI | InChI=1S/C6H10INO3/c7-3-1-9-6-4(11-8)2-10-5(3)6/h3-6H,1-2,8H2 |
| InChIKey | HGBJDUOSDNHVNO-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.05 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|