About 2,3,6-trimethylpyrazolo[3,4-b]pyrazine
2,3,6-trimethylpyrazolo[3,4-b]pyrazine (PubChem CID 166898119) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 2,3,6-trimethylpyrazolo[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 2,3,6-trimethylpyrazolo[3,4-b]pyrazine |
| PubChem CID | 166898119 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2,3,6-trimethylpyrazolo[3,4-b]pyrazine |
| SMILES | Cc1cnc2c(C)n(C)nc2n1 |
| InChI | InChI=1S/C8H10N4/c1-5-4-9-7-6(2)12(3)11-8(7)10-5/h4H,1-3H3 |
| InChIKey | FGBOHRMUJIOGOV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3,6-trimethylpyrazolo[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,6-trimethylpyrazolo[3,4-b]pyrazine?
The IUPAC name of 2,3,6-trimethylpyrazolo[3,4-b]pyrazine (CID 166898119) is 2,3,6-trimethylpyrazolo[3,4-b]pyrazine.
What is the SMILES notation for 2,3,6-trimethylpyrazolo[3,4-b]pyrazine?
The canonical SMILES for 2,3,6-trimethylpyrazolo[3,4-b]pyrazine is Cc1cnc2c(C)n(C)nc2n1.
What is the InChIKey of 2,3,6-trimethylpyrazolo[3,4-b]pyrazine?
The InChIKey is FGBOHRMUJIOGOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-5-4-9-7-6(2)12(3)11-8(7)10-5/h4H,1-3H3.
What are the key properties of 2,3,6-trimethylpyrazolo[3,4-b]pyrazine?
2,3,6-trimethylpyrazolo[3,4-b]pyrazine has a molecular weight of 162.20 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,6-trimethylpyrazolo[3,4-b]pyrazine is sourced from PubChem (CID 166898119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).