About 4,8-dimethylpyrimido[4,5-d]pyridazine
4,8-dimethylpyrimido[4,5-d]pyridazine (PubChem CID 166898202) has the molecular formula C8H8N4
and a molecular weight of 160.18 g/mol. Its IUPAC name is 4,8-dimethylpyrimido[4,5-d]pyridazine.
Molecular Properties
| Compound Name | 4,8-dimethylpyrimido[4,5-d]pyridazine |
| PubChem CID | 166898202 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 4,8-dimethylpyrimido[4,5-d]pyridazine |
| SMILES | Cc1ncnc2c(C)nncc12 |
| InChI | InChI=1S/C8H8N4/c1-5-7-3-11-12-6(2)8(7)10-4-9-5/h3-4H,1-2H3 |
| InChIKey | KXKWZNYTSJBTGK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,8-dimethylpyrimido[4,5-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-dimethylpyrimido[4,5-d]pyridazine?
The IUPAC name of 4,8-dimethylpyrimido[4,5-d]pyridazine (CID 166898202) is 4,8-dimethylpyrimido[4,5-d]pyridazine.
What is the SMILES notation for 4,8-dimethylpyrimido[4,5-d]pyridazine?
The canonical SMILES for 4,8-dimethylpyrimido[4,5-d]pyridazine is Cc1ncnc2c(C)nncc12.
What is the InChIKey of 4,8-dimethylpyrimido[4,5-d]pyridazine?
The InChIKey is KXKWZNYTSJBTGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4/c1-5-7-3-11-12-6(2)8(7)10-4-9-5/h3-4H,1-2H3.
What are the key properties of 4,8-dimethylpyrimido[4,5-d]pyridazine?
4,8-dimethylpyrimido[4,5-d]pyridazine has a molecular weight of 160.18 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-dimethylpyrimido[4,5-d]pyridazine is sourced from PubChem (CID 166898202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).