About 2-(4-chlorophenyl)-5,5-dimethyldibenzothiophene
2-(4-chlorophenyl)-5,5-dimethyldibenzothiophene (PubChem CID 166898686) has the molecular formula C20H17ClS
and a molecular weight of 324.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5,5-dimethyldibenzothiophene.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-5,5-dimethyldibenzothiophene |
| PubChem CID | 166898686 |
| Molecular Formula | C20H17ClS |
| Molecular Weight | 324.88 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-(4-chlorophenyl)-5,5-dimethyldibenzothiophene |
| SMILES | CS1(C)c2ccccc2-c2cc(-c3ccc(Cl)cc3)ccc21 |
| InChI | InChI=1S/C20H17ClS/c1-22(2)19-6-4-3-5-17(19)18-13-15(9-12-20(18)22)14-7-10-16(21)11-8-14/h3-13H,1-2H3 |
| InChIKey | GALUYXLOQPXSNM-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.88 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(4-chlorophenyl)-5,5-dimethyldibenzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-5,5-dimethyldibenzothiophene?
The IUPAC name of 2-(4-chlorophenyl)-5,5-dimethyldibenzothiophene (CID 166898686) is 2-(4-chlorophenyl)-5,5-dimethyldibenzothiophene.
What is the SMILES notation for 2-(4-chlorophenyl)-5,5-dimethyldibenzothiophene?
The canonical SMILES for 2-(4-chlorophenyl)-5,5-dimethyldibenzothiophene is CS1(C)c2ccccc2-c2cc(-c3ccc(Cl)cc3)ccc21.
What is the InChIKey of 2-(4-chlorophenyl)-5,5-dimethyldibenzothiophene?
The InChIKey is GALUYXLOQPXSNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClS/c1-22(2)19-6-4-3-5-17(19)18-13-15(9-12-20(18)22)14-7-10-16(21)11-8-14/h3-13H,1-2H3.
What are the key properties of 2-(4-chlorophenyl)-5,5-dimethyldibenzothiophene?
2-(4-chlorophenyl)-5,5-dimethyldibenzothiophene has a molecular weight of 324.88 g/mol, XLogP of 6.47, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-5,5-dimethyldibenzothiophene is sourced from PubChem (CID 166898686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).