About 4-(6-methyl-2,3,4,5-tetrahydropyridin-4-yl)butan-2-one
4-(6-methyl-2,3,4,5-tetrahydropyridin-4-yl)butan-2-one (PubChem CID 166899000) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 4-(6-methyl-2,3,4,5-tetrahydropyridin-4-yl)butan-2-one.
Molecular Properties
| Compound Name | 4-(6-methyl-2,3,4,5-tetrahydropyridin-4-yl)butan-2-one |
| PubChem CID | 166899000 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 4-(6-methyl-2,3,4,5-tetrahydropyridin-4-yl)butan-2-one |
| SMILES | CC(=O)CCC1CCN=C(C)C1 |
| InChI | InChI=1S/C10H17NO/c1-8-7-10(5-6-11-8)4-3-9(2)12/h10H,3-7H2,1-2H3 |
| InChIKey | PMZNBZDZHRILSF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(6-methyl-2,3,4,5-tetrahydropyridin-4-yl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-methyl-2,3,4,5-tetrahydropyridin-4-yl)butan-2-one?
The IUPAC name of 4-(6-methyl-2,3,4,5-tetrahydropyridin-4-yl)butan-2-one (CID 166899000) is 4-(6-methyl-2,3,4,5-tetrahydropyridin-4-yl)butan-2-one.
What is the SMILES notation for 4-(6-methyl-2,3,4,5-tetrahydropyridin-4-yl)butan-2-one?
The canonical SMILES for 4-(6-methyl-2,3,4,5-tetrahydropyridin-4-yl)butan-2-one is CC(=O)CCC1CCN=C(C)C1.
What is the InChIKey of 4-(6-methyl-2,3,4,5-tetrahydropyridin-4-yl)butan-2-one?
The InChIKey is PMZNBZDZHRILSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-8-7-10(5-6-11-8)4-3-9(2)12/h10H,3-7H2,1-2H3.
What are the key properties of 4-(6-methyl-2,3,4,5-tetrahydropyridin-4-yl)butan-2-one?
4-(6-methyl-2,3,4,5-tetrahydropyridin-4-yl)butan-2-one has a molecular weight of 167.25 g/mol, XLogP of 2.23, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-methyl-2,3,4,5-tetrahydropyridin-4-yl)butan-2-one is sourced from PubChem (CID 166899000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).