C27H25IN4O8 — CID 166899148
N-[(10aR)-9-carbamoyl-7-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-4-pyridin-2-yl-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamoyl iodide (PubChem CID 166899148) has the molecular formula C27H25IN4O8 and a molecular weight of 660.42 g/mol. Its IUPAC name is N-[(10aR)-9-carbamoyl-7-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-4-pyridin-2-yl-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamoyl iodide.
| Compound Name | N-[(10aR)-9-carbamoyl-7-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-4-pyridin-2-yl-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamoyl iodide |
|---|---|
| PubChem CID | 166899148 |
| Molecular Formula | C27H25IN4O8 |
| Molecular Weight | 660.42 g/mol |
| Exact Mass | 660.07 |
| IUPAC Name | N-[(10aR)-9-carbamoyl-7-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-4-pyridin-2-yl-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamoyl iodide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(NC(=O)I)cc(-c5ccccn5)c4CC3CC12 |
| InChI | InChI=1S/C27H25IN4O8/c1-32(2)19-13-8-10-7-12-11(14-5-3-4-6-30-14)9-15(31-26(28)39)20(33)17(12)21(34)16(10)23(36)27(13,40)24(37)18(22(19)35)25(29)38/h3-6,9-10,13,19,33-34,37,40H,7-8H2,1-2H3,(H2,29,38)(H,31,39)/t10?,13?,19?,27-/m0/s1 |
| InChIKey | BCDZNCITXQTJEO-MSBSMVJWSA-N |
| XLogP | 1.99 |
| TPSA | 203.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|