C25H26F2N4O3S — CID 166900027
N-[2,4-difluoro-3-[5-(2-piperidin-4-ylethynyl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]butane-2-sulfonamide (PubChem CID 166900027) has the molecular formula C25H26F2N4O3S and a molecular weight of 500.57 g/mol. Its IUPAC name is N-[2,4-difluoro-3-[5-(2-piperidin-4-ylethynyl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]butane-2-sulfonamide.
| Compound Name | N-[2,4-difluoro-3-[5-(2-piperidin-4-ylethynyl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]butane-2-sulfonamide |
|---|---|
| PubChem CID | 166900027 |
| Molecular Formula | C25H26F2N4O3S |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | N-[2,4-difluoro-3-[5-(2-piperidin-4-ylethynyl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]butane-2-sulfonamide |
| SMILES | CCC(C)S(=O)(=O)Nc1ccc(F)c(C(=O)c2c[nH]c3ncc(C#CC4CCNCC4)cc23)c1F |
| InChI | InChI=1S/C25H26F2N4O3S/c1-3-15(2)35(33,34)31-21-7-6-20(26)22(23(21)27)24(32)19-14-30-25-18(19)12-17(13-29-25)5-4-16-8-10-28-11-9-16/h6-7,12-16,28,31H,3,8-11H2,1-2H3,(H,29,30) |
| InChIKey | YLJHLSVYVLHTMX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|