C4H8N2O2 — CID 166900572
3-methyl-5,6-dihydro-2H-1,2,4-oxadiazin-5-ol (PubChem CID 166900572) has the molecular formula C4H8N2O2 and a molecular weight of 116.12 g/mol. Its IUPAC name is 3-methyl-5,6-dihydro-2H-1,2,4-oxadiazin-5-ol.
| Compound Name | 3-methyl-5,6-dihydro-2H-1,2,4-oxadiazin-5-ol |
|---|---|
| PubChem CID | 166900572 |
| Molecular Formula | C4H8N2O2 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | 3-methyl-5,6-dihydro-2H-1,2,4-oxadiazin-5-ol |
| SMILES | CC1=NC(O)CON1 |
| InChI | InChI=1S/C4H8N2O2/c1-3-5-4(7)2-8-6-3/h4,7H,2H2,1H3,(H,5,6) |
| InChIKey | FEMUNCYECQBWHY-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |